Pigment yellow 65 – Corimax Yellow RN
Technische Parameter von Pigmentgelb 65
| Farbindex Nr. | Pigmentgelb 65 |
| Produktname | Corimax Yellow RN |
| Produktkategorie | Organisches Pigment |
| CAS-Nummer | 6528-34-3 |
| EU-Nummer | 229-419-9 |
| Chemische Familie | Monazo |
| Molekulargewicht | 386.36 |
| Molekularformel | C18H18N4O6 |
| PH Wert | 6.0-7.0 |
| Dichte | 1.6 |
| Ölabsorption (ml / 100 g)% | 35-45 |
| Lichtechtheit (Beschichtung) | 7 |
| Hitzebeständigkeit (Beschichtung) | 140 |
| Wasserbeständigkeit | 5 |
| Ölbeständigkeit | 3 |
| Säurebeständigkeit | 5 |
| Alkalibeständigkeit | 5 |
Farbe | ![]() |
| Farbtonverteilung |
Eigenschaften: Gute Dispersion.
Anwendung:
Empfohlen für Bautenanstriche, Industrielacke.
Verwandte Informationen
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Molekulare Struktur:
Summenformel: C18H18N4O6
Molekulargewicht: 386,36
CAS-Registrierungsnummer: 6528-34-3
Herstellungsverfahren: 4-Methoxy-2-nitrobenzolamin-Diazotierung und N- (2-Methoxyphenyl) -3-oxobutanamid-Kupplung.
Eigenschaften und Anwendungen: leuchtend rot hellgelb. Rotes Pulver. Sonnenlichtechtheit ist besser. Die Resistenz gegen Cellosole, Kerosin, kann Xylol, säurebeständiges Alkali, nicht besser ertragen oder aushalten. In öligem Medium, insbesondere in der verwendeten Latexbeschichtung, kann auch zum Färben von Beschichtungen, Gummi, Kultur- und Bildungsartikeln verwendet werden.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Synonyme
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Berechnete Eigenschaften
| Name des Anwesens | Eigentumswert |
| Molekulargewicht | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Anzahl der Wasserstoffbrückenspender | 1 |
| Anzahl der Wasserstoffbrücken-Akzeptoren | 8 |
| Anzahl drehbarer Anleihen | 7 |
| Genaue Masse | 386.12263431 Da |
| Monoisotopische Masse | 386.12263431 Da |
| Topologische Polaroberfläche | 135 Ų |
| Anzahl schwerer Atome | 28 |
| Formale Ladung | 0 |
| Komplexität | 593 |
| Anzahl der Isotopenatome | 0 |
| Definierte Atom-Stereozentrumsanzahl | 0 |
| Undefinierte Anzahl der Atom-Stereozentren | 1 |
| Definierte Bond-Stereozentren-Anzahl | 0 |
| Anzahl undefinierter Bindungsstereozentren | 0 |
| Anzahl der kovalent gebundenen Einheiten | 1 |
| Verbindung wird kanonisiert | Ja |











